C22H22N2O4 — CID 102079124
dimethyl 5,8-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4(9),6,13,15,17-pentaene-5,8-dicarboxylate (PubChem CID 102079124) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is dimethyl 5,8-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4(9),6,13,15,17-pentaene-5,8-dicarboxylate.
| Compound Name | dimethyl 5,8-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4(9),6,13,15,17-pentaene-5,8-dicarboxylate |
|---|---|
| PubChem CID | 102079124 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | dimethyl 5,8-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4(9),6,13,15,17-pentaene-5,8-dicarboxylate |
| SMILES | COC(=O)N1C=CN(C(=O)OC)C2=C1C1CC2C2C3CC(c4ccccc43)C12 |
| InChI | InChI=1S/C22H22N2O4/c1-27-21(25)23-7-8-24(22(26)28-2)20-16-10-15(19(20)23)17-13-9-14(18(16)17)12-6-4-3-5-11(12)13/h3-8,13-18H,9-10H2,1-2H3 |
| InChIKey | KVCCFDHGSALMMN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|