C12H12O4S2 — CID 134890371
dimethyl 1,4-dihydro-2,3-benzodithiine-1,4-dicarboxylate (PubChem CID 134890371) has the molecular formula C12H12O4S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is dimethyl 1,4-dihydro-2,3-benzodithiine-1,4-dicarboxylate.
| Compound Name | dimethyl 1,4-dihydro-2,3-benzodithiine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134890371 |
| Molecular Formula | C12H12O4S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | dimethyl 1,4-dihydro-2,3-benzodithiine-1,4-dicarboxylate |
| SMILES | COC(=O)C1SSC(C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C12H12O4S2/c1-15-11(13)9-7-5-3-4-6-8(7)10(18-17-9)12(14)16-2/h3-6,9-10H,1-2H3 |
| InChIKey | QUTCBAMSCGWCRP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|