C10H9BrO3 — CID 95212351
methyl (2R,3R)-3-(2-bromophenyl)oxirane-2-carboxylate (PubChem CID 95212351) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is methyl (2R,3R)-3-(2-bromophenyl)oxirane-2-carboxylate.
| Compound Name | methyl (2R,3R)-3-(2-bromophenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 95212351 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | methyl (2R,3R)-3-(2-bromophenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C10H9BrO3/c1-13-10(12)9-8(14-9)6-4-2-3-5-7(6)11/h2-5,8-9H,1H3/t8-,9-/m1/s1 |
| InChIKey | NHTXEKYZHJGFMB-RKDXNWHRSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|