C12H13IO4 — CID 175424086
methyl (2R)-5-(2-iodophenyl)-2-methyl-1,3-dioxolane-4-carboxylate (PubChem CID 175424086) has the molecular formula C12H13IO4 and a molecular weight of 348.14 g/mol. Its IUPAC name is methyl (2R)-5-(2-iodophenyl)-2-methyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (2R)-5-(2-iodophenyl)-2-methyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 175424086 |
| Molecular Formula | C12H13IO4 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | methyl (2R)-5-(2-iodophenyl)-2-methyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)C1O[C@H](C)OC1c1ccccc1I |
| InChI | InChI=1S/C12H13IO4/c1-7-16-10(11(17-7)12(14)15-2)8-5-3-4-6-9(8)13/h3-7,10-11H,1-2H3/t7-,10?,11?/m1/s1 |
| InChIKey | ADJSTZGNQDCVHW-CAZGOSDBSA-N |
| XLogP | 2.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|