About dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate
dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate (PubChem CID 13146086) has the molecular formula C12H12O6
and a molecular weight of 252.22 g/mol. Its IUPAC name is dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate.
Analyze dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate?
The IUPAC name of dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate (CID 13146086) is dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate?
The canonical SMILES for dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate is COC(=O)C1Oc2c(O)cccc2C1C(=O)OC.
What is the InChIKey of dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate?
The InChIKey is FAXUDUADEFJZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O6/c1-16-11(14)8-6-4-3-5-7(13)9(6)18-10(8)12(15)17-2/h3-5,8,10,13H,1-2H3.
What are the key properties of dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate?
dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate has a molecular weight of 252.22 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 7-hydroxy-2,3-dihydro-1-benzofuran-2,3-dicarboxylate is sourced from PubChem (CID 13146086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).