C11H12O3 — CID 14295972
methyl (2S,3R)-3-(2-methylphenyl)oxirane-2-carboxylate (PubChem CID 14295972) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is methyl (2S,3R)-3-(2-methylphenyl)oxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-(2-methylphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 14295972 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | methyl (2S,3R)-3-(2-methylphenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H]1c1ccccc1C |
| InChI | InChI=1S/C11H12O3/c1-7-5-3-4-6-8(7)9-10(14-9)11(12)13-2/h3-6,9-10H,1-2H3/t9-,10+/m1/s1 |
| InChIKey | OGMDARHEXLJCGY-ZJUUUORDSA-N |
| XLogP | 1.61 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|