C10H11NO2 — CID 55266155
(2R,3S)-3-(2-methylphenyl)oxirane-2-carboxamide (PubChem CID 55266155) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2R,3S)-3-(2-methylphenyl)oxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-(2-methylphenyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 55266155 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2R,3S)-3-(2-methylphenyl)oxirane-2-carboxamide |
| SMILES | Cc1ccccc1[C@@H]1O[C@H]1C(N)=O |
| InChI | InChI=1S/C10H11NO2/c1-6-4-2-3-5-7(6)8-9(13-8)10(11)12/h2-5,8-9H,1H3,(H2,11,12)/t8-,9+/m0/s1 |
| InChIKey | VOVFJVXRQISFMW-DTWKUNHWSA-N |
| XLogP | 0.92 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|