C10H9NO — CID 101249405
(2S,3S)-3-(2-methylphenyl)oxirane-2-carbonitrile (PubChem CID 101249405) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is (2S,3S)-3-(2-methylphenyl)oxirane-2-carbonitrile.
| Compound Name | (2S,3S)-3-(2-methylphenyl)oxirane-2-carbonitrile |
|---|---|
| PubChem CID | 101249405 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (2S,3S)-3-(2-methylphenyl)oxirane-2-carbonitrile |
| SMILES | Cc1ccccc1[C@@H]1O[C@H]1C#N |
| InChI | InChI=1S/C10H9NO/c1-7-4-2-3-5-8(7)10-9(6-11)12-10/h2-5,9-10H,1H3/t9-,10-/m0/s1 |
| InChIKey | WSNQNOFNCUAOHI-UWVGGRQHSA-N |
| XLogP | 1.96 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|