C19H21ClO — CID 11033937
(2S,6R)-4-chloro-2,6-bis(2-methylphenyl)oxane (PubChem CID 11033937) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is (2S,6R)-4-chloro-2,6-bis(2-methylphenyl)oxane.
| Compound Name | (2S,6R)-4-chloro-2,6-bis(2-methylphenyl)oxane |
|---|---|
| PubChem CID | 11033937 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2S,6R)-4-chloro-2,6-bis(2-methylphenyl)oxane |
| SMILES | Cc1ccccc1[C@@H]1CC(Cl)C[C@H](c2ccccc2C)O1 |
| InChI | InChI=1S/C19H21ClO/c1-13-7-3-5-9-16(13)18-11-15(20)12-19(21-18)17-10-6-4-8-14(17)2/h3-10,15,18-19H,11-12H2,1-2H3/t15?,18-,19+ |
| InChIKey | XPOMZXJDLYERRS-QNBRMCRTSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|