C9H6BrNO — CID 102332905
(2R,3R)-3-(4-bromophenyl)oxirane-2-carbonitrile (PubChem CID 102332905) has the molecular formula C9H6BrNO and a molecular weight of 224.06 g/mol. Its IUPAC name is (2R,3R)-3-(4-bromophenyl)oxirane-2-carbonitrile.
| Compound Name | (2R,3R)-3-(4-bromophenyl)oxirane-2-carbonitrile |
|---|---|
| PubChem CID | 102332905 |
| Molecular Formula | C9H6BrNO |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | (2R,3R)-3-(4-bromophenyl)oxirane-2-carbonitrile |
| SMILES | N#C[C@H]1O[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H6BrNO/c10-7-3-1-6(2-4-7)9-8(5-11)12-9/h1-4,8-9H/t8-,9-/m1/s1 |
| InChIKey | WDTWREAHWIBHKO-RKDXNWHRSA-N |
| XLogP | 2.41 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|