C13H5BrN4 — CID 3349632
3-(4-bromophenyl)cyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 3349632) has the molecular formula C13H5BrN4 and a molecular weight of 297.12 g/mol. Its IUPAC name is 3-(4-bromophenyl)cyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-(4-bromophenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 3349632 |
| Molecular Formula | C13H5BrN4 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 3-(4-bromophenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccc(Br)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C13H5BrN4/c14-10-3-1-9(2-4-10)11-12(5-15,6-16)13(11,7-17)8-18/h1-4,11H |
| InChIKey | PLESPFDEFJZOMX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|