C18H12N4O3 — CID 102378475
2-[4-(2,2,3,3-tetracyanocyclopropyl)phenoxy]ethyl prop-2-enoate (PubChem CID 102378475) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[4-(2,2,3,3-tetracyanocyclopropyl)phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-(2,2,3,3-tetracyanocyclopropyl)phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 102378475 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[4-(2,2,3,3-tetracyanocyclopropyl)phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C2C(C#N)(C#N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C18H12N4O3/c1-2-15(23)25-8-7-24-14-5-3-13(4-6-14)16-17(9-19,10-20)18(16,11-21)12-22/h2-6,16H,1,7-8H2 |
| InChIKey | XPLRFCUSMSICJX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 130.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|