C20H12Br2N6 — CID 14813941
(3S,6R)-3,6-bis(4-bromophenyl)piperazine-2,2,5,5-tetracarbonitrile (PubChem CID 14813941) has the molecular formula C20H12Br2N6 and a molecular weight of 496.17 g/mol. Its IUPAC name is (3S,6R)-3,6-bis(4-bromophenyl)piperazine-2,2,5,5-tetracarbonitrile.
| Compound Name | (3S,6R)-3,6-bis(4-bromophenyl)piperazine-2,2,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 14813941 |
| Molecular Formula | C20H12Br2N6 |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | (3S,6R)-3,6-bis(4-bromophenyl)piperazine-2,2,5,5-tetracarbonitrile |
| SMILES | N#CC1(C#N)N[C@@H](c2ccc(Br)cc2)C(C#N)(C#N)N[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H12Br2N6/c21-15-5-1-13(2-6-15)17-19(9-23,10-24)28-18(20(11-25,12-26)27-17)14-3-7-16(22)8-4-14/h1-8,17-18,27-28H/t17-,18+ |
| InChIKey | XSWGPLJGTHSQGB-HDICACEKSA-N |
| XLogP | 3.76 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |