C14H11BrN2O — CID 11833595
(2R,4R)-2-(4-bromophenyl)-4-ethenyloxolane-3,3-dicarbonitrile (PubChem CID 11833595) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is (2R,4R)-2-(4-bromophenyl)-4-ethenyloxolane-3,3-dicarbonitrile.
| Compound Name | (2R,4R)-2-(4-bromophenyl)-4-ethenyloxolane-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 11833595 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | (2R,4R)-2-(4-bromophenyl)-4-ethenyloxolane-3,3-dicarbonitrile |
| SMILES | C=C[C@H]1CO[C@H](c2ccc(Br)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C14H11BrN2O/c1-2-11-7-18-13(14(11,8-16)9-17)10-3-5-12(15)6-4-10/h2-6,11,13H,1,7H2/t11-,13+/m0/s1 |
| InChIKey | LUIZLPHYCNNOCE-WCQYABFASA-N |
| XLogP | 3.36 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|