C15H19BrO2 — CID 139123245
(4S,5S)-4-(4-bromophenyl)-5-ethenyl-2,2,5-trimethyl-1,3-dioxane (PubChem CID 139123245) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is (4S,5S)-4-(4-bromophenyl)-5-ethenyl-2,2,5-trimethyl-1,3-dioxane.
| Compound Name | (4S,5S)-4-(4-bromophenyl)-5-ethenyl-2,2,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 139123245 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4S,5S)-4-(4-bromophenyl)-5-ethenyl-2,2,5-trimethyl-1,3-dioxane |
| SMILES | C=C[C@@]1(C)COC(C)(C)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrO2/c1-5-15(4)10-17-14(2,3)18-13(15)11-6-8-12(16)9-7-11/h5-9,13H,1,10H2,2-4H3/t13-,15-/m0/s1 |
| InChIKey | AEGPNWCOEHTRJY-ZFWWWQNUSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|