C16H19Br — CID 10924264
1-[(2S,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]-4-bromobenzene (PubChem CID 10924264) has the molecular formula C16H19Br and a molecular weight of 291.23 g/mol. Its IUPAC name is 1-[(2S,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]-4-bromobenzene.
| Compound Name | 1-[(2S,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]-4-bromobenzene |
|---|---|
| PubChem CID | 10924264 |
| Molecular Formula | C16H19Br |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-[(2S,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]-4-bromobenzene |
| SMILES | C=C[C@@H]1CC[C@@H](C=C)C1(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H19Br/c1-4-12-6-7-13(5-2)16(12,3)14-8-10-15(17)11-9-14/h4-5,8-13H,1-2,6-7H2,3H3/t12-,13-/m1/s1 |
| InChIKey | SEYQZQSAAQYUBJ-CHWSQXEVSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|