About 1-bromo-4-ethenylbenzene;ethane
1-bromo-4-ethenylbenzene;ethane (PubChem CID 144688744) has the molecular formula C10H13Br
and a molecular weight of 213.12 g/mol. Its IUPAC name is 1-bromo-4-ethenylbenzene;ethane.
Molecular Properties
| Compound Name | 1-bromo-4-ethenylbenzene;ethane |
| PubChem CID | 144688744 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-bromo-4-ethenylbenzene;ethane |
| SMILES | C=Cc1ccc(Br)cc1.CC |
| InChI | InChI=1S/C8H7Br.C2H6/c1-2-7-3-5-8(9)6-4-7;1-2/h2-6H,1H2;1-2H3 |
| InChIKey | ZQJMEEDZAAKBAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-ethenylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethenylbenzene;ethane?
The IUPAC name of 1-bromo-4-ethenylbenzene;ethane (CID 144688744) is 1-bromo-4-ethenylbenzene;ethane.
What is the SMILES notation for 1-bromo-4-ethenylbenzene;ethane?
The canonical SMILES for 1-bromo-4-ethenylbenzene;ethane is C=Cc1ccc(Br)cc1.CC.
What is the InChIKey of 1-bromo-4-ethenylbenzene;ethane?
The InChIKey is ZQJMEEDZAAKBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br.C2H6/c1-2-7-3-5-8(9)6-4-7;1-2/h2-6H,1H2;1-2H3.
What are the key properties of 1-bromo-4-ethenylbenzene;ethane?
1-bromo-4-ethenylbenzene;ethane has a molecular weight of 213.12 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethenylbenzene;ethane is sourced from PubChem (CID 144688744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).