C12H13BrO2 — CID 155935062
(5S)-5-(4-bromophenyl)-3,3-dimethyloxolan-2-one (PubChem CID 155935062) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is (5S)-5-(4-bromophenyl)-3,3-dimethyloxolan-2-one.
| Compound Name | (5S)-5-(4-bromophenyl)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 155935062 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (5S)-5-(4-bromophenyl)-3,3-dimethyloxolan-2-one |
| SMILES | CC1(C)C[C@@H](c2ccc(Br)cc2)OC1=O |
| InChI | InChI=1S/C12H13BrO2/c1-12(2)7-10(15-11(12)14)8-3-5-9(13)6-4-8/h3-6,10H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | WCDYDRJGHLILIS-JTQLQIEISA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |