C13H16O3 — CID 155935569
(5S)-5-(2-methoxyphenyl)-3,3-dimethyloxolan-2-one (PubChem CID 155935569) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (5S)-5-(2-methoxyphenyl)-3,3-dimethyloxolan-2-one.
| Compound Name | (5S)-5-(2-methoxyphenyl)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 155935569 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (5S)-5-(2-methoxyphenyl)-3,3-dimethyloxolan-2-one |
| SMILES | COc1ccccc1[C@@H]1CC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C13H16O3/c1-13(2)8-11(16-12(13)14)9-6-4-5-7-10(9)15-3/h4-7,11H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | CANMLGNBBLPHRB-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |