C14H18O — CID 134968527
1-methoxy-2-[(1S,2S)-2-methyl-2-prop-1-en-2-ylcyclopropyl]benzene (PubChem CID 134968527) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-methoxy-2-[(1S,2S)-2-methyl-2-prop-1-en-2-ylcyclopropyl]benzene.
| Compound Name | 1-methoxy-2-[(1S,2S)-2-methyl-2-prop-1-en-2-ylcyclopropyl]benzene |
|---|---|
| PubChem CID | 134968527 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-methoxy-2-[(1S,2S)-2-methyl-2-prop-1-en-2-ylcyclopropyl]benzene |
| SMILES | C=C(C)[C@@]1(C)C[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C14H18O/c1-10(2)14(3)9-12(14)11-7-5-6-8-13(11)15-4/h5-8,12H,1,9H2,2-4H3/t12-,14-/m1/s1 |
| InChIKey | YPKOQQSIYRYBMJ-TZMCWYRMSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|