C19H14O4 — CID 175916705
2-(2-methoxyphenyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 175916705) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-(2-methoxyphenyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 175916705 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1ccccc1C1CC2=C(O1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H14O4/c1-22-15-9-5-4-8-13(15)16-10-14-17(20)11-6-2-3-7-12(11)18(21)19(14)23-16/h2-9,16H,10H2,1H3 |
| InChIKey | FPLKDDGDVJMWFN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|