C18H18O4 — CID 44584420
(2R)-5-methoxy-2-(3-methylbut-2-en-2-yl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 44584420) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R)-5-methoxy-2-(3-methylbut-2-en-2-yl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2R)-5-methoxy-2-(3-methylbut-2-en-2-yl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 44584420 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2R)-5-methoxy-2-(3-methylbut-2-en-2-yl)-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1cccc2c1C(=O)C1=C(O[C@@H](C(C)=C(C)C)C1)C2=O |
| InChI | InChI=1S/C18H18O4/c1-9(2)10(3)14-8-12-16(19)15-11(17(20)18(12)22-14)6-5-7-13(15)21-4/h5-7,14H,8H2,1-4H3/t14-/m1/s1 |
| InChIKey | AFZWCFAGRAKUEJ-CQSZACIVSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|