C16H14O5 — CID 162938161
(2S,3S)-3-hydroxy-5-methoxy-2-prop-1-en-2-yl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 162938161) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-5-methoxy-2-prop-1-en-2-yl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2S,3S)-3-hydroxy-5-methoxy-2-prop-1-en-2-yl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 162938161 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2S,3S)-3-hydroxy-5-methoxy-2-prop-1-en-2-yl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | C=C(C)[C@@H]1OC2=C(C(=O)c3c(OC)cccc3C2=O)[C@@H]1O |
| InChI | InChI=1S/C16H14O5/c1-7(2)15-14(19)11-13(18)10-8(12(17)16(11)21-15)5-4-6-9(10)20-3/h4-6,14-15,19H,1H2,2-3H3/t14-,15-/m0/s1 |
| InChIKey | PWZYXEDCZFMAPK-GJZGRUSLSA-N |
| XLogP | 1.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|