C21H22O5 — CID 123863601
6,11-dihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;ethane (PubChem CID 123863601) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 6,11-dihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;ethane.
| Compound Name | 6,11-dihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;ethane |
|---|---|
| PubChem CID | 123863601 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 6,11-dihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;ethane |
| SMILES | CC.COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CCCC3 |
| InChI | InChI=1S/C19H16O5.C2H6/c1-24-12-8-4-7-11-13(12)19(23)15-14(18(11)22)16(20)9-5-2-3-6-10(9)17(15)21;1-2/h4,7-8,20-21H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | RLUMNPCRFJFNQU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|