C22H20O7 — CID 123421599
6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-9-methyl-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 123421599) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-9-methyl-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-9-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 123421599 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-9-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C)(C(=O)CO)CC3 |
| InChI | InChI=1S/C22H20O7/c1-22(14(24)9-23)7-6-10-12(8-22)20(27)16-17(18(10)25)21(28)15-11(19(16)26)4-3-5-13(15)29-2/h3-5,23,25,27H,6-9H2,1-2H3 |
| InChIKey | DLFWOJJGTBPRFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|