C28H30O7 — CID 130253694
(7R,9S)-9-acetyl-6,11-dihydroxy-4-methoxy-9-methyl-7-[[(2R)-oxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 130253694) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is (7R,9S)-9-acetyl-6,11-dihydroxy-4-methoxy-9-methyl-7-[[(2R)-oxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,9S)-9-acetyl-6,11-dihydroxy-4-methoxy-9-methyl-7-[[(2R)-oxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 130253694 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (7R,9S)-9-acetyl-6,11-dihydroxy-4-methoxy-9-methyl-7-[[(2R)-oxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](C)(C(C)=O)C[C@@H]3C[C@H]1CCCCO1 |
| InChI | InChI=1S/C28H30O7/c1-14(29)28(2)12-15(11-16-7-4-5-10-35-16)20-18(13-28)25(31)22-23(26(20)32)27(33)21-17(24(22)30)8-6-9-19(21)34-3/h6,8-9,15-16,31-32H,4-5,7,10-13H2,1-3H3/t15-,16+,28-/m0/s1 |
| InChIKey | NVDARBFEGIXHRC-JMLKKNOCSA-N |
| XLogP | 4.47 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|