C28H30O8 — CID 147260872
(7S,9R)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[[(2R,6S)-6-methyloxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 147260872) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is (7S,9R)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[[(2R,6S)-6-methyloxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9R)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[[(2R,6S)-6-methyloxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 147260872 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (7S,9R)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[[(2R,6S)-6-methyloxan-2-yl]methyl]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3C[C@H]1CCC[C@H](C)O1 |
| InChI | InChI=1S/C28H30O8/c1-13-6-4-7-16(36-13)10-15-11-28(34,14(2)29)12-18-20(15)26(32)23-22(25(18)31)24(30)17-8-5-9-19(35-3)21(17)27(23)33/h5,8-9,13,15-16,31-32,34H,4,6-7,10-12H2,1-3H3/t13-,15-,16+,28+/m0/s1 |
| InChIKey | CONIJNYWQCLMKS-MKHDBLRASA-N |
| XLogP | 3.58 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|