C27H28O9S — CID 89160514
(7S,9S)-6,9,11-trihydroxy-4-methoxy-7-[(2S,6S)-6-methyloxan-2-yl]oxy-9-(2-sulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 89160514) has the molecular formula C27H28O9S and a molecular weight of 528.58 g/mol. Its IUPAC name is (7S,9S)-6,9,11-trihydroxy-4-methoxy-7-[(2S,6S)-6-methyloxan-2-yl]oxy-9-(2-sulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-6,9,11-trihydroxy-4-methoxy-7-[(2S,6S)-6-methyloxan-2-yl]oxy-9-(2-sulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 89160514 |
| Molecular Formula | C27H28O9S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | (7S,9S)-6,9,11-trihydroxy-4-methoxy-7-[(2S,6S)-6-methyloxan-2-yl]oxy-9-(2-sulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CS)C[C@@H]3O[C@H]1CCC[C@H](C)O1 |
| InChI | InChI=1S/C27H28O9S/c1-12-5-3-8-18(35-12)36-16-10-27(33,17(28)11-37)9-14-20(16)26(32)22-21(24(14)30)23(29)13-6-4-7-15(34-2)19(13)25(22)31/h4,6-7,12,16,18,30,32-33,37H,3,5,8-11H2,1-2H3/t12-,16-,18-,27-/m0/s1 |
| InChIKey | MEEDSMTZXZXDGF-LHIWLQOYSA-N |
| XLogP | 3.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|