C26H26O9 — CID 118584244
(9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(2S)-oxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 118584244) has the molecular formula C26H26O9 and a molecular weight of 482.49 g/mol. Its IUPAC name is (9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(2S)-oxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(2S)-oxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 118584244 |
| Molecular Formula | C26H26O9 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(2S)-oxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)CC3O[C@H]1CCCCO1 |
| InChI | InChI=1S/C26H26O9/c1-12(27)26(32)10-14-19(16(11-26)35-17-8-3-4-9-34-17)25(31)21-20(23(14)29)22(28)13-6-5-7-15(33-2)18(13)24(21)30/h5-7,16-17,29,31-32H,3-4,8-11H2,1-2H3/t16?,17-,26-/m0/s1 |
| InChIKey | KXQHLSHXOBDVOL-AVFFZSMJSA-N |
| XLogP | 2.73 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|