C24H20O7 — CID 143845208
(7S,9S)-9-ethynyl-6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 143845208) has the molecular formula C24H20O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is (7S,9S)-9-ethynyl-6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-ethynyl-6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 143845208 |
| Molecular Formula | C24H20O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (7S,9S)-9-ethynyl-6,11-dihydroxy-9-(2-hydroxyacetyl)-4-methoxy-7-methyl-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | C#C[C@@]1(C(=O)CO)Cc2c(O)c3c(c(O)c2[C@@H](C)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C24H20O7/c1-4-24(15(26)10-25)8-11(2)16-13(9-24)21(28)18-19(22(16)29)23(30)17-12(20(18)27)6-5-7-14(17)31-3/h1,5-7,11,25,28-29H,8-10H2,2-3H3/t11-,24-/m0/s1 |
| InChIKey | JBIKEOCZBWVGDF-BUBHHJDNSA-N |
| XLogP | 2.11 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|