C19H16O3 — CID 10565565
11-methoxy-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione (PubChem CID 10565565) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 11-methoxy-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione.
| Compound Name | 11-methoxy-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 10565565 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 11-methoxy-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(ccc3c1CCCC3)C2=O |
| InChI | InChI=1S/C19H16O3/c1-22-15-8-4-7-13-17(15)19(21)16-12-6-3-2-5-11(12)9-10-14(16)18(13)20/h4,7-10H,2-3,5-6H2,1H3 |
| InChIKey | AMROTDOVVDYICY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|