C22H21NO6S — CID 145041168
(2S)-5,12-dihydroxy-7-methoxy-6,11-dioxo-N-(2-sulfanylethyl)-1,2,3,4-tetrahydrotetracene-2-carboxamide (PubChem CID 145041168) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is (2S)-5,12-dihydroxy-7-methoxy-6,11-dioxo-N-(2-sulfanylethyl)-1,2,3,4-tetrahydrotetracene-2-carboxamide.
| Compound Name | (2S)-5,12-dihydroxy-7-methoxy-6,11-dioxo-N-(2-sulfanylethyl)-1,2,3,4-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 145041168 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2S)-5,12-dihydroxy-7-methoxy-6,11-dioxo-N-(2-sulfanylethyl)-1,2,3,4-tetrahydrotetracene-2-carboxamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@H](C(=O)NCCS)CC3 |
| InChI | InChI=1S/C22H21NO6S/c1-29-14-4-2-3-12-15(14)21(27)17-16(19(12)25)20(26)13-9-10(22(28)23-7-8-30)5-6-11(13)18(17)24/h2-4,10,24,26,30H,5-9H2,1H3,(H,23,28)/t10-/m0/s1 |
| InChIKey | RNXXZNCZTQWGFZ-JTQLQIEISA-N |
| XLogP | 2.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|