C29H34N4O8 — CID 171818374
N-[3-[3-[(2-formamidoacetyl)amino]propylamino]propyl]-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide (PubChem CID 171818374) has the molecular formula C29H34N4O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is N-[3-[3-[(2-formamidoacetyl)amino]propylamino]propyl]-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide.
| Compound Name | N-[3-[3-[(2-formamidoacetyl)amino]propylamino]propyl]-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 171818374 |
| Molecular Formula | C29H34N4O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | N-[3-[3-[(2-formamidoacetyl)amino]propylamino]propyl]-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C(=O)NCCCNCCCNC(=O)CNC=O)CC3 |
| InChI | InChI=1S/C29H34N4O8/c1-41-20-6-2-5-18-22(20)28(39)24-23(26(18)37)27(38)19-13-16(7-8-17(19)25(24)36)29(40)33-12-4-10-30-9-3-11-32-21(35)14-31-15-34/h2,5-6,15-16,30,36,38H,3-4,7-14H2,1H3,(H,31,34)(H,32,35)(H,33,40) |
| InChIKey | RJHURVFFTHZRCA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 183.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|