C27H30O10 — CID 145305319
(8S)-6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;(6S)-6-methyloxane-2,5-diol (PubChem CID 145305319) has the molecular formula C27H30O10 and a molecular weight of 514.53 g/mol. Its IUPAC name is (8S)-6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;(6S)-6-methyloxane-2,5-diol.
| Compound Name | (8S)-6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;(6S)-6-methyloxane-2,5-diol |
|---|---|
| PubChem CID | 145305319 |
| Molecular Formula | C27H30O10 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (8S)-6,11-dihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;(6S)-6-methyloxane-2,5-diol |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@H](C(=O)CO)CC3.C[C@@H]1OC(O)CCC1O |
| InChI | InChI=1S/C21H18O7.C6H12O3/c1-28-14-4-2-3-11-15(14)21(27)17-16(19(11)25)20(26)12-7-9(13(23)8-22)5-6-10(12)18(17)24;1-4-5(7)2-3-6(8)9-4/h2-4,9,22,24,26H,5-8H2,1H3;4-8H,2-3H2,1H3/t9-;4-,5?,6?/m00/s1 |
| InChIKey | AKSVNJFVARZCNK-HSSGQJGVSA-N |
| XLogP | 1.41 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|