C23H21F3N2O6 — CID 171538472
N-(2-amino-3,3,3-trifluoropropyl)-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide (PubChem CID 171538472) has the molecular formula C23H21F3N2O6 and a molecular weight of 478.42 g/mol. Its IUPAC name is N-(2-amino-3,3,3-trifluoropropyl)-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide.
| Compound Name | N-(2-amino-3,3,3-trifluoropropyl)-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 171538472 |
| Molecular Formula | C23H21F3N2O6 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-(2-amino-3,3,3-trifluoropropyl)-5,12-dihydroxy-7-methoxy-6,11-dioxo-1,2,3,4-tetrahydrotetracene-2-carboxamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(C(=O)NCC(N)C(F)(F)F)CC3 |
| InChI | InChI=1S/C23H21F3N2O6/c1-34-13-4-2-3-11-15(13)21(32)17-16(19(11)30)20(31)12-7-9(5-6-10(12)18(17)29)22(33)28-8-14(27)23(24,25)26/h2-4,9,14,29,31H,5-8,27H2,1H3,(H,28,33) |
| InChIKey | LPPBIQWRBXEMTF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|