C12H14O3 — CID 100945529
(1S,4R,6R)-4-(2-methoxyphenyl)-3,7-dioxabicyclo[4.1.0]heptane (PubChem CID 100945529) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,4R,6R)-4-(2-methoxyphenyl)-3,7-dioxabicyclo[4.1.0]heptane.
| Compound Name | (1S,4R,6R)-4-(2-methoxyphenyl)-3,7-dioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 100945529 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1S,4R,6R)-4-(2-methoxyphenyl)-3,7-dioxabicyclo[4.1.0]heptane |
| SMILES | COc1ccccc1[C@H]1C[C@H]2O[C@H]2CO1 |
| InChI | InChI=1S/C12H14O3/c1-13-9-5-3-2-4-8(9)10-6-11-12(15-11)7-14-10/h2-5,10-12H,6-7H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | XOGLBGPZKGSGMB-UTUOFQBUSA-N |
| XLogP | 1.92 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|