C11H13ClO3 — CID 36690087
(2R,4R)-4-(chloromethyl)-2-(2-methoxyphenyl)-1,3-dioxolane (PubChem CID 36690087) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is (2R,4R)-4-(chloromethyl)-2-(2-methoxyphenyl)-1,3-dioxolane.
| Compound Name | (2R,4R)-4-(chloromethyl)-2-(2-methoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 36690087 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (2R,4R)-4-(chloromethyl)-2-(2-methoxyphenyl)-1,3-dioxolane |
| SMILES | COc1ccccc1[C@@H]1OC[C@H](CCl)O1 |
| InChI | InChI=1S/C11H13ClO3/c1-13-10-5-3-2-4-9(10)11-14-7-8(6-12)15-11/h2-5,8,11H,6-7H2,1H3/t8-,11+/m0/s1 |
| InChIKey | FGZZEMGDNLVORZ-GZMMTYOYSA-N |
| XLogP | 2.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|