C11H13ClO4 — CID 82778659
5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-2-methoxyphenol (PubChem CID 82778659) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-2-methoxyphenol.
| Compound Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 82778659 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-[4-(chloromethyl)-1,3-dioxolan-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc(C2OCC(CCl)O2)cc1O |
| InChI | InChI=1S/C11H13ClO4/c1-14-10-3-2-7(4-9(10)13)11-15-6-8(5-12)16-11/h2-4,8,11,13H,5-6H2,1H3 |
| InChIKey | YBTZKRICMMQUOQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|