C14H20O4 — CID 53392727
(2S,4R,5S)-2-(3,4-dimethoxyphenyl)-4,5-dimethyl-1,3-dioxane (PubChem CID 53392727) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S,4R,5S)-2-(3,4-dimethoxyphenyl)-4,5-dimethyl-1,3-dioxane.
| Compound Name | (2S,4R,5S)-2-(3,4-dimethoxyphenyl)-4,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 53392727 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2S,4R,5S)-2-(3,4-dimethoxyphenyl)-4,5-dimethyl-1,3-dioxane |
| SMILES | COc1ccc([C@H]2OC[C@H](C)[C@@H](C)O2)cc1OC |
| InChI | InChI=1S/C14H20O4/c1-9-8-17-14(18-10(9)2)11-5-6-12(15-3)13(7-11)16-4/h5-7,9-10,14H,8H2,1-4H3/t9-,10+,14-/m0/s1 |
| InChIKey | HRHJIKGUXGCFDY-RBZYPMLTSA-N |
| XLogP | 2.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |