About oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate
oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate (PubChem CID 161042496) has the molecular formula C14H27O8+
and a molecular weight of 323.36 g/mol. Its IUPAC name is oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate.
Molecular Properties
| Compound Name | oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate |
| PubChem CID | 161042496 |
| Molecular Formula | C14H27O8+ |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate |
| SMILES | CC(O)CO.COc1cc(C2OCC(C)O2)ccc1O.O.[OH3+] |
| InChI | InChI=1S/C11H14O4.C3H8O2.2H2O/c1-7-6-14-11(15-7)8-3-4-9(12)10(5-8)13-2;1-3(5)2-4;;/h3-5,7,11-12H,6H2,1-2H3;3-5H,2H2,1H3;2*1H2/p+1 |
| InChIKey | XKPISPSOUOQXSF-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate?
The IUPAC name of oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate (CID 161042496) is oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate.
What is the SMILES notation for oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate?
The canonical SMILES for oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate is CC(O)CO.COc1cc(C2OCC(C)O2)ccc1O.O.[OH3+].
What is the InChIKey of oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate?
The InChIKey is XKPISPSOUOQXSF-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H14O4.C3H8O2.2H2O/c1-7-6-14-11(15-7)8-3-4-9(12)10(5-8)13-2;1-3(5)2-4;;/h3-5,7,11-12H,6H2,1-2H3;3-5H,2H2,1H3;2*1H2/p+1.
What are the key properties of oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate?
oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate has a molecular weight of 323.36 g/mol, XLogP of -0.55, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxidanium;2-methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol;propane-1,2-diol;hydrate is sourced from PubChem (CID 161042496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).