C19H20O5 — CID 100938571
2,5-bis(4-hydroxy-3-methoxyphenyl)cyclopentan-1-one (PubChem CID 100938571) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2,5-bis(4-hydroxy-3-methoxyphenyl)cyclopentan-1-one.
| Compound Name | 2,5-bis(4-hydroxy-3-methoxyphenyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 100938571 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2,5-bis(4-hydroxy-3-methoxyphenyl)cyclopentan-1-one |
| SMILES | COc1cc(C2CCC(c3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C19H20O5/c1-23-17-9-11(3-7-15(17)20)13-5-6-14(19(13)22)12-4-8-16(21)18(10-12)24-2/h3-4,7-10,13-14,20-21H,5-6H2,1-2H3 |
| InChIKey | VDDCDLYWPQXNHT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |