C21H20N4O8 — CID 22331027
7,11-bis(4-hydroxy-3-methoxyphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 22331027) has the molecular formula C21H20N4O8 and a molecular weight of 456.41 g/mol. Its IUPAC name is 7,11-bis(4-hydroxy-3-methoxyphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | 7,11-bis(4-hydroxy-3-methoxyphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 22331027 |
| Molecular Formula | C21H20N4O8 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 7,11-bis(4-hydroxy-3-methoxyphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | COc1cc(C2NC(=O)NC(c3ccc(O)c(OC)c3)C23C(=O)NC(=O)NC3=O)ccc1O |
| InChI | InChI=1S/C21H20N4O8/c1-32-13-7-9(3-5-11(13)26)15-21(17(28)24-20(31)25-18(21)29)16(23-19(30)22-15)10-4-6-12(27)14(8-10)33-2/h3-8,15-16,26-27H,1-2H3,(H2,22,23,30)(H2,24,25,28,29,31) |
| InChIKey | ABNWIDLOWBLPEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|