C10H10N2O2S2 — CID 4019771
5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dithione (PubChem CID 4019771) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dithione.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dithione |
|---|---|
| PubChem CID | 4019771 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dithione |
| SMILES | COc1cc(C2NC(=S)NC2=S)ccc1O |
| InChI | InChI=1S/C10H10N2O2S2/c1-14-7-4-5(2-3-6(7)13)8-9(15)12-10(16)11-8/h2-4,8,13H,1H3,(H2,11,12,15,16) |
| InChIKey | XVLIBSZUZJINOJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|