C10H10N2O4 — CID 699519
(5R)-5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 699519) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is (5R)-5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 699519 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1cc([C@H]2NC(=O)NC2=O)ccc1O |
| InChI | InChI=1S/C10H10N2O4/c1-16-7-4-5(2-3-6(7)13)8-9(14)12-10(15)11-8/h2-4,8,13H,1H3,(H2,11,12,14,15)/t8-/m1/s1 |
| InChIKey | NMMXNKFEJWUXOT-MRVPVSSYSA-N |
| XLogP | 0.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|