C11H14O6S2 — CID 676994
2-methoxy-4-(1,1,3,3-tetraoxo-1,3-dithian-5-yl)phenol (PubChem CID 676994) has the molecular formula C11H14O6S2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-methoxy-4-(1,1,3,3-tetraoxo-1,3-dithian-5-yl)phenol.
| Compound Name | 2-methoxy-4-(1,1,3,3-tetraoxo-1,3-dithian-5-yl)phenol |
|---|---|
| PubChem CID | 676994 |
| Molecular Formula | C11H14O6S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-methoxy-4-(1,1,3,3-tetraoxo-1,3-dithian-5-yl)phenol |
| SMILES | COc1cc(C2CS(=O)(=O)CS(=O)(=O)C2)ccc1O |
| InChI | InChI=1S/C11H14O6S2/c1-17-11-4-8(2-3-10(11)12)9-5-18(13,14)7-19(15,16)6-9/h2-4,9,12H,5-7H2,1H3 |
| InChIKey | XHQOWQKJHUFCNE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |