C13H14N2O5S — CID 136965642
4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol (PubChem CID 136965642) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol.
| Compound Name | 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 136965642 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2nc(C3CCS(=O)(=O)C3)no2)ccc1O |
| InChI | InChI=1S/C13H14N2O5S/c1-19-11-6-8(2-3-10(11)16)13-14-12(15-20-13)9-4-5-21(17,18)7-9/h2-3,6,9,16H,4-5,7H2,1H3 |
| InChIKey | OWZGCYHWYXSPBM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |