C13H12N2O5S — CID 115336067
2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]benzoic acid (PubChem CID 115336067) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]benzoic acid.
| Compound Name | 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 115336067 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1nc(C2CCS(=O)(=O)C2)no1 |
| InChI | InChI=1S/C13H12N2O5S/c16-13(17)10-4-2-1-3-9(10)12-14-11(15-20-12)8-5-6-21(18,19)7-8/h1-4,8H,5-7H2,(H,16,17) |
| InChIKey | NRDVXSJBFGLXTB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |