C13H15N3O4S — CID 115411915
2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-4-methoxyaniline (PubChem CID 115411915) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-4-methoxyaniline.
| Compound Name | 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-4-methoxyaniline |
|---|---|
| PubChem CID | 115411915 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-4-methoxyaniline |
| SMILES | COc1ccc(N)c(-c2nc(C3CCS(=O)(=O)C3)no2)c1 |
| InChI | InChI=1S/C13H15N3O4S/c1-19-9-2-3-11(14)10(6-9)13-15-12(16-20-13)8-4-5-21(17,18)7-8/h2-3,6,8H,4-5,7,14H2,1H3 |
| InChIKey | KGDSCUAWLFUIHA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|