C13H15N3O3S — CID 115335909
4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methylaniline (PubChem CID 115335909) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methylaniline.
| Compound Name | 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methylaniline |
|---|---|
| PubChem CID | 115335909 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]-2-methylaniline |
| SMILES | Cc1cc(-c2nc(C3CCS(=O)(=O)C3)no2)ccc1N |
| InChI | InChI=1S/C13H15N3O3S/c1-8-6-9(2-3-11(8)14)13-15-12(16-19-13)10-4-5-20(17,18)7-10/h2-3,6,10H,4-5,7,14H2,1H3 |
| InChIKey | LGVCYXKKCCANKY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|