C24H30O6 — CID 11825831
(2S,4S,5S)-2-(4-methoxyphenyl)-4-[(2S,4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-5-methyl-1,3-dioxane (PubChem CID 11825831) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S,4S,5S)-2-(4-methoxyphenyl)-4-[(2S,4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-5-methyl-1,3-dioxane.
| Compound Name | (2S,4S,5S)-2-(4-methoxyphenyl)-4-[(2S,4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 11825831 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S,4S,5S)-2-(4-methoxyphenyl)-4-[(2S,4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-5-methyl-1,3-dioxane |
| SMILES | COc1ccc([C@H]2OC[C@H](C)[C@@H]([C@H]3O[C@@H](c4ccc(OC)cc4)OC[C@@H]3C)O2)cc1 |
| InChI | InChI=1S/C24H30O6/c1-15-13-27-23(17-5-9-19(25-3)10-6-17)29-21(15)22-16(2)14-28-24(30-22)18-7-11-20(26-4)12-8-18/h5-12,15-16,21-24H,13-14H2,1-4H3/t15-,16-,21-,22-,23-,24-/m0/s1 |
| InChIKey | CHMKWGXYUSABIG-ZNVGPNBVSA-N |
| XLogP | 4.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |